About (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite
(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite (PubChem CID 142457368) has the molecular formula C6H8FNO3
and a molecular weight of 161.13 g/mol. Its IUPAC name is (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite.
Molecular Properties
| Compound Name | (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite |
| PubChem CID | 142457368 |
| Molecular Formula | C6H8FNO3 |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite |
| SMILES | CC1C(=O)N(OF)C(=O)C1C |
| InChI | InChI=1S/C6H8FNO3/c1-3-4(2)6(10)8(11-7)5(3)9/h3-4H,1-2H3 |
| InChIKey | XMWNCAMROBRQDC-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite?
The IUPAC name of (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite (CID 142457368) is (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite.
What is the SMILES notation for (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite?
The canonical SMILES for (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite is CC1C(=O)N(OF)C(=O)C1C.
What is the InChIKey of (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite?
The InChIKey is XMWNCAMROBRQDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8FNO3/c1-3-4(2)6(10)8(11-7)5(3)9/h3-4H,1-2H3.
What are the key properties of (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite?
(3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite has a molecular weight of 161.13 g/mol, XLogP of 0.44, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethyl-2,5-dioxopyrrolidin-1-yl) hypofluorite is sourced from PubChem (CID 142457368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).