C12H12F3N2O3+ — CID 142458466
methyl 2-methoxy-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-3-carboxylate (PubChem CID 142458466) has the molecular formula C12H12F3N2O3+ and a molecular weight of 289.23 g/mol. Its IUPAC name is methyl 2-methoxy-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-3-carboxylate.
| Compound Name | methyl 2-methoxy-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 142458466 |
| Molecular Formula | C12H12F3N2O3+ |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | methyl 2-methoxy-1-(2,2,2-trifluoroethyl)imidazo[1,2-a]pyridin-1-ium-3-carboxylate |
| SMILES | COC(=O)c1c(OC)[n+](CC(F)(F)F)c2ccccn12 |
| InChI | InChI=1S/C12H12F3N2O3/c1-19-10-9(11(18)20-2)16-6-4-3-5-8(16)17(10)7-12(13,14)15/h3-6H,7H2,1-2H3/q+1 |
| InChIKey | RBVGTSAUXQBBOW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 43.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|