C23H28FN5O2 — CID 142458516
N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminopropylamino]ethyl]-1,3-oxazole-4-carboxamide (PubChem CID 142458516) has the molecular formula C23H28FN5O2 and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminopropylamino]ethyl]-1,3-oxazole-4-carboxamide.
| Compound Name | N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminopropylamino]ethyl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 142458516 |
| Molecular Formula | C23H28FN5O2 |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | N-[(3-fluoro-2-pyridinyl)methyl]-2-[2-[2-[(4Z)-2-methylhepta-2,4,6-trien-3-yl]iminopropylamino]ethyl]-1,3-oxazole-4-carboxamide |
| SMILES | C=C/C=C\C(/N=C(\C)CNCCc1nc(C(=O)NCc2ncccc2F)co1)=C(C)C |
| InChI | InChI=1S/C23H28FN5O2/c1-5-6-9-19(16(2)3)28-17(4)13-25-12-10-22-29-21(15-31-22)23(30)27-14-20-18(24)8-7-11-26-20/h5-9,11,15,25H,1,10,12-14H2,2-4H3,(H,27,30)/b9-6-,28-17+ |
| InChIKey | UTKGJCRLMMVEDC-VDAYPHAFSA-N |
| XLogP | 3.77 |
| TPSA | 92.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|