C20H22Br2N2 — CID 14245867
(3R,4R,8aS)-3,4-bis(4-bromophenyl)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 14245867) has the molecular formula C20H22Br2N2 and a molecular weight of 450.22 g/mol. Its IUPAC name is (3R,4R,8aS)-3,4-bis(4-bromophenyl)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | (3R,4R,8aS)-3,4-bis(4-bromophenyl)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 14245867 |
| Molecular Formula | C20H22Br2N2 |
| Molecular Weight | 450.22 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | (3R,4R,8aS)-3,4-bis(4-bromophenyl)-2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | CN1C[C@@H]2CCCN2[C@H](c2ccc(Br)cc2)[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C20H22Br2N2/c1-23-13-18-3-2-12-24(18)20(15-6-10-17(22)11-7-15)19(23)14-4-8-16(21)9-5-14/h4-11,18-20H,2-3,12-13H2,1H3/t18-,19+,20+/m0/s1 |
| InChIKey | BOZAIZAWEADFSA-XUVXKRRUSA-N |
| XLogP | 5.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.22 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |