About 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione
3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione (PubChem CID 142458899) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione.
Molecular Properties
| Compound Name | 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione |
| PubChem CID | 142458899 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione |
| SMILES | CC1C=Cc2oc(=O)n(C)c(=O)c2C=C1 |
| InChI | InChI=1S/C11H11NO3/c1-7-3-5-8-9(6-4-7)15-11(14)12(2)10(8)13/h3-7H,1-2H3 |
| InChIKey | UNWXBTXZYSHHSO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 52.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione?
The IUPAC name of 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione (CID 142458899) is 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione.
What is the SMILES notation for 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione?
The canonical SMILES for 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione is CC1C=Cc2oc(=O)n(C)c(=O)c2C=C1.
What is the InChIKey of 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione?
The InChIKey is UNWXBTXZYSHHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c1-7-3-5-8-9(6-4-7)15-11(14)12(2)10(8)13/h3-7H,1-2H3.
What are the key properties of 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione?
3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione has a molecular weight of 205.21 g/mol, XLogP of 1.01, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyl-7H-cyclohepta[e][1,3]oxazine-2,4-dione is sourced from PubChem (CID 142458899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).