C18H30F2N2 — CID 142459332
N-[[1-[(4E)-4-ethenyl-3,3-difluoro-2-methylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine (PubChem CID 142459332) has the molecular formula C18H30F2N2 and a molecular weight of 312.45 g/mol. Its IUPAC name is N-[[1-[(4E)-4-ethenyl-3,3-difluoro-2-methylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine.
| Compound Name | N-[[1-[(4E)-4-ethenyl-3,3-difluoro-2-methylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 142459332 |
| Molecular Formula | C18H30F2N2 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | N-[[1-[(4E)-4-ethenyl-3,3-difluoro-2-methylhepta-4,6-dien-2-yl]piperidin-4-yl]methyl]ethanamine |
| SMILES | C=C/C=C(\C=C)C(F)(F)C(C)(C)N1CCC(CNCC)CC1 |
| InChI | InChI=1S/C18H30F2N2/c1-6-9-16(7-2)18(19,20)17(4,5)22-12-10-15(11-13-22)14-21-8-3/h6-7,9,15,21H,1-2,8,10-14H2,3-5H3/b16-9+ |
| InChIKey | ZAAQTVXXBXGMEQ-CXUHLZMHSA-N |
| XLogP | 4.02 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|