C9H13F3N4O2S — CID 142460300
ethyl N-[[4-(trifluoromethyl)-1H-pyrazol-5-yl]carbamothioyl]carbamate;methane (PubChem CID 142460300) has the molecular formula C9H13F3N4O2S and a molecular weight of 298.29 g/mol. Its IUPAC name is ethyl N-[[4-(trifluoromethyl)-1H-pyrazol-5-yl]carbamothioyl]carbamate;methane.
| Compound Name | ethyl N-[[4-(trifluoromethyl)-1H-pyrazol-5-yl]carbamothioyl]carbamate;methane |
|---|---|
| PubChem CID | 142460300 |
| Molecular Formula | C9H13F3N4O2S |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | ethyl N-[[4-(trifluoromethyl)-1H-pyrazol-5-yl]carbamothioyl]carbamate;methane |
| SMILES | C.CCOC(=O)NC(=S)Nc1[nH]ncc1C(F)(F)F |
| InChI | InChI=1S/C8H9F3N4O2S.CH4/c1-2-17-7(16)14-6(18)13-5-4(3-12-15-5)8(9,10)11;/h3H,2H2,1H3,(H3,12,13,14,15,16,18);1H4 |
| InChIKey | STNMQIGICLURJM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|