About 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine
2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine (PubChem CID 142460472) has the molecular formula C16H24N4OS2
and a molecular weight of 352.53 g/mol. Its IUPAC name is 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine |
| PubChem CID | 142460472 |
| Molecular Formula | C16H24N4OS2 |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine |
| SMILES | COc1ccc(-c2cn(CCSSCCN(C)C)nn2)c(C)c1 |
| InChI | InChI=1S/C16H24N4OS2/c1-13-11-14(21-4)5-6-15(13)16-12-20(18-17-16)8-10-23-22-9-7-19(2)3/h5-6,11-12H,7-10H2,1-4H3 |
| InChIKey | OBZINZCKOZDBQC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine?
The IUPAC name of 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine (CID 142460472) is 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine is COc1ccc(-c2cn(CCSSCCN(C)C)nn2)c(C)c1.
What is the InChIKey of 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine?
The InChIKey is OBZINZCKOZDBQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N4OS2/c1-13-11-14(21-4)5-6-15(13)16-12-20(18-17-16)8-10-23-22-9-7-19(2)3/h5-6,11-12H,7-10H2,1-4H3.
What are the key properties of 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine?
2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine has a molecular weight of 352.53 g/mol, XLogP of 3.21, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(4-methoxy-2-methylphenyl)triazol-1-yl]ethyldisulfanyl]-N,N-dimethylethanamine is sourced from PubChem (CID 142460472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).