C12H23NO2 — CID 142460710
3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 142460710) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 142460710 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-[(2E,4E)-4-methoxyhexa-2,4-dien-3-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | C/C=C(OC)\C(=C/C)OCCCN(C)C |
| InChI | InChI=1S/C12H23NO2/c1-6-11(14-5)12(7-2)15-10-8-9-13(3)4/h6-7H,8-10H2,1-5H3/b11-6+,12-7+ |
| InChIKey | NXOZUSSUGULQQC-GNXRPPCSSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|