About 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione
1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione (PubChem CID 142461028) has the molecular formula C26H18O2S2
and a molecular weight of 426.56 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione.
Molecular Properties
| Compound Name | 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione |
| PubChem CID | 142461028 |
| Molecular Formula | C26H18O2S2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione |
| SMILES | O=C1c2cccc(Sc3ccccc3)c2C(=O)c2c(SC3C=CC=CC3)cccc21 |
| InChI | InChI=1S/C26H18O2S2/c27-25-19-13-7-15-21(29-17-9-3-1-4-10-17)23(19)26(28)24-20(25)14-8-16-22(24)30-18-11-5-2-6-12-18/h1-11,13-16,18H,12H2 |
| InChIKey | YAYQQMFPTSSZHG-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione?
The IUPAC name of 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione (CID 142461028) is 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione.
What is the SMILES notation for 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione?
The canonical SMILES for 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione is O=C1c2cccc(Sc3ccccc3)c2C(=O)c2c(SC3C=CC=CC3)cccc21.
What is the InChIKey of 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione?
The InChIKey is YAYQQMFPTSSZHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18O2S2/c27-25-19-13-7-15-21(29-17-9-3-1-4-10-17)23(19)26(28)24-20(25)14-8-16-22(24)30-18-11-5-2-6-12-18/h1-11,13-16,18H,12H2.
What are the key properties of 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione?
1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione has a molecular weight of 426.56 g/mol, XLogP of 6.59, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,4-dien-1-ylsulfanyl-8-phenylsulfanylanthracene-9,10-dione is sourced from PubChem (CID 142461028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).