C24H23N — CID 142461131
(18Z,21Z)-14-azapentacyclo[15.5.1.03,15.04,13.07,12]tricosa-1,3(15),4(13),5,7,9,11,16,18,21-decaene;ethane (PubChem CID 142461131) has the molecular formula C24H23N and a molecular weight of 325.46 g/mol. Its IUPAC name is (18Z,21Z)-14-azapentacyclo[15.5.1.03,15.04,13.07,12]tricosa-1,3(15),4(13),5,7,9,11,16,18,21-decaene;ethane.
| Compound Name | (18Z,21Z)-14-azapentacyclo[15.5.1.03,15.04,13.07,12]tricosa-1,3(15),4(13),5,7,9,11,16,18,21-decaene;ethane |
|---|---|
| PubChem CID | 142461131 |
| Molecular Formula | C24H23N |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (18Z,21Z)-14-azapentacyclo[15.5.1.03,15.04,13.07,12]tricosa-1,3(15),4(13),5,7,9,11,16,18,21-decaene;ethane |
| SMILES | C1=C2/C=C\C/C=C\C(=Cc3c1[nH]c1c3ccc3ccccc31)C2.CC |
| InChI | InChI=1S/C22H17N.C2H6/c1-2-6-15-12-16(7-3-1)14-21-20(13-15)19-11-10-17-8-4-5-9-18(17)22(19)23-21;1-2/h2-11,13-14,23H,1,12H2;1-2H3/b6-2-,7-3-; |
| InChIKey | AZQASALBRJVTOD-GVTDOVSOSA-N |
| XLogP | 7.03 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |