C24H24Cl2F3N3O2S — CID 142461257
5-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-5-(trifluoromethyl)-4H-1,2-thiazole;N-(1-methyl-2-oxopyrrolidin-3-yl)formamide (PubChem CID 142461257) has the molecular formula C24H24Cl2F3N3O2S and a molecular weight of 546.44 g/mol. Its IUPAC name is 5-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-5-(trifluoromethyl)-4H-1,2-thiazole;N-(1-methyl-2-oxopyrrolidin-3-yl)formamide.
| Compound Name | 5-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-5-(trifluoromethyl)-4H-1,2-thiazole;N-(1-methyl-2-oxopyrrolidin-3-yl)formamide |
|---|---|
| PubChem CID | 142461257 |
| Molecular Formula | C24H24Cl2F3N3O2S |
| Molecular Weight | 546.44 g/mol |
| Exact Mass | 545.09 |
| IUPAC Name | 5-(3,5-dichlorophenyl)-3-(3,4-dimethylphenyl)-5-(trifluoromethyl)-4H-1,2-thiazole;N-(1-methyl-2-oxopyrrolidin-3-yl)formamide |
| SMILES | CN1CCC(NC=O)C1=O.Cc1ccc(C2=NSC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C18H14Cl2F3NS.C6H10N2O2/c1-10-3-4-12(5-11(10)2)16-9-17(25-24-16,18(21,22)23)13-6-14(19)8-15(20)7-13;1-8-3-2-5(6(8)10)7-4-9/h3-8H,9H2,1-2H3;4-5H,2-3H2,1H3,(H,7,9) |
| InChIKey | CFYXVSPMMJYENY-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|