About [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate
[3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate (PubChem CID 142461306) has the molecular formula C17H30N2O4
and a molecular weight of 326.44 g/mol. Its IUPAC name is [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate.
Molecular Properties
| Compound Name | [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate |
| PubChem CID | 142461306 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate |
| SMILES | CCCCCC1=NN(C(=O)CCOC(C)=O)OC(CCCC)C1 |
| InChI | InChI=1S/C17H30N2O4/c1-4-6-8-9-15-13-16(10-7-5-2)23-19(18-15)17(21)11-12-22-14(3)20/h16H,4-13H2,1-3H3 |
| InChIKey | VLTBDTJTCXAUPS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate?
The IUPAC name of [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate (CID 142461306) is [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate.
What is the SMILES notation for [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate?
The canonical SMILES for [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate is CCCCCC1=NN(C(=O)CCOC(C)=O)OC(CCCC)C1.
What is the InChIKey of [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate?
The InChIKey is VLTBDTJTCXAUPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O4/c1-4-6-8-9-15-13-16(10-7-5-2)23-19(18-15)17(21)11-12-22-14(3)20/h16H,4-13H2,1-3H3.
What are the key properties of [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate?
[3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate has a molecular weight of 326.44 g/mol, XLogP of 3.60, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(6-butyl-4-pentyl-5,6-dihydrooxadiazin-2-yl)-3-oxopropyl] acetate is sourced from PubChem (CID 142461306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).