C25H19BrF3NO — CID 142461449
2-(4-bromophenyl)-5-[3-(methoxymethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole (PubChem CID 142461449) has the molecular formula C25H19BrF3NO and a molecular weight of 486.33 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-[3-(methoxymethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole.
| Compound Name | 2-(4-bromophenyl)-5-[3-(methoxymethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole |
|---|---|
| PubChem CID | 142461449 |
| Molecular Formula | C25H19BrF3NO |
| Molecular Weight | 486.33 g/mol |
| Exact Mass | 485.06 |
| IUPAC Name | 2-(4-bromophenyl)-5-[3-(methoxymethyl)phenyl]-1-[2-(trifluoromethyl)phenyl]pyrrole |
| SMILES | COCc1cccc(-c2ccc(-c3ccc(Br)cc3)n2-c2ccccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H19BrF3NO/c1-31-16-17-5-4-6-19(15-17)23-14-13-22(18-9-11-20(26)12-10-18)30(23)24-8-3-2-7-21(24)25(27,28)29/h2-15H,16H2,1H3 |
| InChIKey | JPXHHQIVFDZQHV-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.33 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |