About [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate
[8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate (PubChem CID 142461581) has the molecular formula C26H19F2N3O3
and a molecular weight of 459.45 g/mol. Its IUPAC name is [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate.
Molecular Properties
| Compound Name | [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate |
| PubChem CID | 142461581 |
| Molecular Formula | C26H19F2N3O3 |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate |
| SMILES | CC(=O)Oc1c(Cc2ccco2)nc2c(Cc3c(F)cccc3F)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C26H19F2N3O3/c1-16(32)34-26-23(13-18-9-6-12-33-18)30-25-22(14-19-20(27)10-5-11-21(19)28)29-24(15-31(25)26)17-7-3-2-4-8-17/h2-12,15H,13-14H2,1H3 |
| InChIKey | PUCMYTYWGLPMBP-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 69.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate?
The IUPAC name of [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate (CID 142461581) is [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate.
What is the SMILES notation for [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate?
The canonical SMILES for [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate is CC(=O)Oc1c(Cc2ccco2)nc2c(Cc3c(F)cccc3F)nc(-c3ccccc3)cn12.
What is the InChIKey of [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate?
The InChIKey is PUCMYTYWGLPMBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19F2N3O3/c1-16(32)34-26-23(13-18-9-6-12-33-18)30-25-22(14-19-20(27)10-5-11-21(19)28)29-24(15-31(25)26)17-7-3-2-4-8-17/h2-12,15H,13-14H2,1H3.
What are the key properties of [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate?
[8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate has a molecular weight of 459.45 g/mol, XLogP of 5.37, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-[(2,6-difluorophenyl)methyl]-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl] acetate is sourced from PubChem (CID 142461581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).