About ethane;hexyl dec-9-enoate
ethane;hexyl dec-9-enoate (PubChem CID 142461660) has the molecular formula C18H36O2
and a molecular weight of 284.48 g/mol. Its IUPAC name is ethane;hexyl dec-9-enoate.
Molecular Properties
| Compound Name | ethane;hexyl dec-9-enoate |
| PubChem CID | 142461660 |
| Molecular Formula | C18H36O2 |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.27 |
| IUPAC Name | ethane;hexyl dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)OCCCCCC.CC |
| InChI | InChI=1S/C16H30O2.C2H6/c1-3-5-7-9-10-11-12-14-16(17)18-15-13-8-6-4-2;1-2/h3H,1,4-15H2,2H3;1-2H3 |
| InChIKey | BNYSDXLDRHGDBG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;hexyl dec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;hexyl dec-9-enoate?
The IUPAC name of ethane;hexyl dec-9-enoate (CID 142461660) is ethane;hexyl dec-9-enoate.
What is the SMILES notation for ethane;hexyl dec-9-enoate?
The canonical SMILES for ethane;hexyl dec-9-enoate is C=CCCCCCCCC(=O)OCCCCCC.CC.
What is the InChIKey of ethane;hexyl dec-9-enoate?
The InChIKey is BNYSDXLDRHGDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30O2.C2H6/c1-3-5-7-9-10-11-12-14-16(17)18-15-13-8-6-4-2;1-2/h3H,1,4-15H2,2H3;1-2H3.
What are the key properties of ethane;hexyl dec-9-enoate?
ethane;hexyl dec-9-enoate has a molecular weight of 284.48 g/mol, XLogP of 6.05, 13 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;hexyl dec-9-enoate is sourced from PubChem (CID 142461660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).