About CID 142461684
CID 142461684 (PubChem CID 142461684) has the molecular formula C12H5BBrF3
and a molecular weight of 296.88 g/mol.
Molecular Properties
| Compound Name | CID 142461684 |
| PubChem CID | 142461684 |
| Molecular Formula | C12H5BBrF3 |
| Molecular Weight | 296.88 g/mol |
| Exact Mass | 295.96 |
| IUPAC Name | — |
| SMILES | [B]c1c(F)c(-c2ccccc2)c(F)c(F)c1Br |
| InChI | InChI=1S/C12H5BBrF3/c13-8-9(14)12(17)11(16)7(10(8)15)6-4-2-1-3-5-6/h1-5H |
| InChIKey | HJXNZHISABGFFM-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 142461684 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 142461684?
The IUPAC name of CID 142461684 (CID 142461684) is not available.
What is the SMILES notation for CID 142461684?
The canonical SMILES for CID 142461684 is [B]c1c(F)c(-c2ccccc2)c(F)c(F)c1Br.
What is the InChIKey of CID 142461684?
The InChIKey is HJXNZHISABGFFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5BBrF3/c13-8-9(14)12(17)11(16)7(10(8)15)6-4-2-1-3-5-6/h1-5H.
What are the key properties of CID 142461684?
CID 142461684 has a molecular weight of 296.88 g/mol, XLogP of 3.33, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 142461684 is sourced from PubChem (CID 142461684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).