About (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane
(E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane (PubChem CID 142462160) has the molecular formula C11H22N4
and a molecular weight of 210.32 g/mol. Its IUPAC name is (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane.
Molecular Properties
| Compound Name | (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane |
| PubChem CID | 142462160 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane |
| SMILES | C=N/C(C)=C(/N=C/C)C(\N)=N\C.CCC |
| InChI | InChI=1S/C8H14N4.C3H8/c1-5-12-7(6(2)10-3)8(9)11-4;1-3-2/h5H,3H2,1-2,4H3,(H2,9,11);3H2,1-2H3/b7-6+,12-5+; |
| InChIKey | RPDHCSXXERTRTA-ODOMZQCFSA-N |
| XLogP | 2.41 |
| TPSA | 63.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane?
The IUPAC name of (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane (CID 142462160) is (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane.
What is the SMILES notation for (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane?
The canonical SMILES for (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane is C=N/C(C)=C(/N=C/C)C(\N)=N\C.CCC.
What is the InChIKey of (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane?
The InChIKey is RPDHCSXXERTRTA-ODOMZQCFSA-N. The full InChI is InChI=1S/C8H14N4.C3H8/c1-5-12-7(6(2)10-3)8(9)11-4;1-3-2/h5H,3H2,1-2,4H3,(H2,9,11);3H2,1-2H3/b7-6+,12-5+;.
What are the key properties of (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane?
(E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane has a molecular weight of 210.32 g/mol, XLogP of 2.41, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-(ethylideneamino)-N'-methyl-3-(methylideneamino)but-2-enimidamide;propane is sourced from PubChem (CID 142462160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).