C32H36N6O3 — CID 142464799
2-[3-[4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]anilino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-pentan-3-ylacetamide (PubChem CID 142464799) has the molecular formula C32H36N6O3 and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-[3-[4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]anilino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-pentan-3-ylacetamide.
| Compound Name | 2-[3-[4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]anilino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 142464799 |
| Molecular Formula | C32H36N6O3 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 2-[3-[4-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]anilino]-6-ethoxyquinazolin-2-yl]phenoxy]-N-pentan-3-ylacetamide |
| SMILES | [H]/N=C/C(=C\N)c1ccc(Nc2nc(-c3cccc(OCC(=O)NC(CC)CC)c3)nc3ccc(OCC)cc23)cc1 |
| InChI | InChI=1S/C32H36N6O3/c1-4-24(5-2)35-30(39)20-41-26-9-7-8-22(16-26)31-37-29-15-14-27(40-6-3)17-28(29)32(38-31)36-25-12-10-21(11-13-25)23(18-33)19-34/h7-19,24,33H,4-6,20,34H2,1-3H3,(H,35,39)(H,36,37,38)/b23-19+,33-18+ |
| InChIKey | FMRMMNYBKAOUKU-RVTSEUEBSA-N |
| XLogP | 6.07 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|