About methanethiol;(E)-3-pyridin-3-ylprop-2-enamide
methanethiol;(E)-3-pyridin-3-ylprop-2-enamide (PubChem CID 142465005) has the molecular formula C9H12N2OS
and a molecular weight of 196.28 g/mol. Its IUPAC name is methanethiol;(E)-3-pyridin-3-ylprop-2-enamide.
Molecular Properties
| Compound Name | methanethiol;(E)-3-pyridin-3-ylprop-2-enamide |
| PubChem CID | 142465005 |
| Molecular Formula | C9H12N2OS |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | methanethiol;(E)-3-pyridin-3-ylprop-2-enamide |
| SMILES | CS.NC(=O)/C=C/c1cccnc1 |
| InChI | InChI=1S/C8H8N2O.CH4S/c9-8(11)4-3-7-2-1-5-10-6-7;1-2/h1-6H,(H2,9,11);2H,1H3/b4-3+; |
| InChIKey | AZELXUBQLLKZRO-BJILWQEISA-N |
| XLogP | 1.13 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;(E)-3-pyridin-3-ylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;(E)-3-pyridin-3-ylprop-2-enamide?
The IUPAC name of methanethiol;(E)-3-pyridin-3-ylprop-2-enamide (CID 142465005) is methanethiol;(E)-3-pyridin-3-ylprop-2-enamide.
What is the SMILES notation for methanethiol;(E)-3-pyridin-3-ylprop-2-enamide?
The canonical SMILES for methanethiol;(E)-3-pyridin-3-ylprop-2-enamide is CS.NC(=O)/C=C/c1cccnc1.
What is the InChIKey of methanethiol;(E)-3-pyridin-3-ylprop-2-enamide?
The InChIKey is AZELXUBQLLKZRO-BJILWQEISA-N. The full InChI is InChI=1S/C8H8N2O.CH4S/c9-8(11)4-3-7-2-1-5-10-6-7;1-2/h1-6H,(H2,9,11);2H,1H3/b4-3+;.
What are the key properties of methanethiol;(E)-3-pyridin-3-ylprop-2-enamide?
methanethiol;(E)-3-pyridin-3-ylprop-2-enamide has a molecular weight of 196.28 g/mol, XLogP of 1.13, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;(E)-3-pyridin-3-ylprop-2-enamide is sourced from PubChem (CID 142465005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).