C24H26N6O3 — CID 142465044
8-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(1H-indazol-7-yl)octanamide (PubChem CID 142465044) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is 8-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(1H-indazol-7-yl)octanamide.
| Compound Name | 8-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(1H-indazol-7-yl)octanamide |
|---|---|
| PubChem CID | 142465044 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 8-[[3,4-dioxo-2-(pyridin-4-ylamino)cyclobuten-1-yl]amino]-N-(1H-indazol-7-yl)octanamide |
| SMILES | O=C(CCCCCCCNc1c(Nc2ccncc2)c(=O)c1=O)Nc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C24H26N6O3/c31-19(29-18-8-6-7-16-15-27-30-20(16)18)9-4-2-1-3-5-12-26-21-22(24(33)23(21)32)28-17-10-13-25-14-11-17/h6-8,10-11,13-15,26H,1-5,9,12H2,(H,25,28)(H,27,30)(H,29,31) |
| InChIKey | GWQKKPDARFAATP-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|