C32H40N2O7S — CID 142465116
N-(2-hydroxyethylsulfonyl)-8-methyl-2-(3-methyl-4,5-dihydro-1-benzofuran-2-yl)-5-[(2,2,6,6-tetramethyloxan-4-yl)methoxy]quinoline-4-carboxamide (PubChem CID 142465116) has the molecular formula C32H40N2O7S and a molecular weight of 596.75 g/mol. Its IUPAC name is N-(2-hydroxyethylsulfonyl)-8-methyl-2-(3-methyl-4,5-dihydro-1-benzofuran-2-yl)-5-[(2,2,6,6-tetramethyloxan-4-yl)methoxy]quinoline-4-carboxamide.
| Compound Name | N-(2-hydroxyethylsulfonyl)-8-methyl-2-(3-methyl-4,5-dihydro-1-benzofuran-2-yl)-5-[(2,2,6,6-tetramethyloxan-4-yl)methoxy]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 142465116 |
| Molecular Formula | C32H40N2O7S |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | N-(2-hydroxyethylsulfonyl)-8-methyl-2-(3-methyl-4,5-dihydro-1-benzofuran-2-yl)-5-[(2,2,6,6-tetramethyloxan-4-yl)methoxy]quinoline-4-carboxamide |
| SMILES | Cc1c(-c2cc(C(=O)NS(=O)(=O)CCO)c3c(OCC4CC(C)(C)OC(C)(C)C4)ccc(C)c3n2)oc2c1CCC=C2 |
| InChI | InChI=1S/C32H40N2O7S/c1-19-11-12-26(39-18-21-16-31(3,4)41-32(5,6)17-21)27-23(30(36)34-42(37,38)14-13-35)15-24(33-28(19)27)29-20(2)22-9-7-8-10-25(22)40-29/h8,10-12,15,21,35H,7,9,13-14,16-18H2,1-6H3,(H,34,36) |
| InChIKey | CAHZDDHZFQANMY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 127.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |