C17H20F5N7O3S — CID 142465381
1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea;molecular hydrogen (PubChem CID 142465381) has the molecular formula C17H20F5N7O3S and a molecular weight of 497.45 g/mol. Its IUPAC name is 1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea;molecular hydrogen.
| Compound Name | 1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea;molecular hydrogen |
|---|---|
| PubChem CID | 142465381 |
| Molecular Formula | C17H20F5N7O3S |
| Molecular Weight | 497.45 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | 1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea;molecular hydrogen |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)NC)nc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C.[H][H].[H][H] |
| InChI | InChI=1S/C17H16F5N7O3S.2H2/c1-4-33(31,32)9-5-6-11(26-15(30)23-2)25-12(9)14-24-8-7-10(16(18,19)17(20,21)22)27-28-13(8)29(14)3;;/h5-7H,4H2,1-3H3,(H2,23,25,26,30);2*1H |
| InChIKey | BNDXLULPBRLFJK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|