C18H18F5N7O3S — CID 142465385
3-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,1-dimethylurea (PubChem CID 142465385) has the molecular formula C18H18F5N7O3S and a molecular weight of 507.45 g/mol. Its IUPAC name is 3-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,1-dimethylurea.
| Compound Name | 3-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 142465385 |
| Molecular Formula | C18H18F5N7O3S |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | 3-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,1-dimethylurea |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)N(C)C)nc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C18H18F5N7O3S/c1-5-34(32,33)10-6-7-12(26-16(31)29(2)3)25-13(10)15-24-9-8-11(17(19,20)18(21,22)23)27-28-14(9)30(15)4/h6-8H,5H2,1-4H3,(H,25,26,31) |
| InChIKey | BGUDHYLBZVBYAW-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|