C19H20F5N7O3S — CID 142465392
1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3,3-trimethylurea (PubChem CID 142465392) has the molecular formula C19H20F5N7O3S and a molecular weight of 521.47 g/mol. Its IUPAC name is 1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3,3-trimethylurea.
| Compound Name | 1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3,3-trimethylurea |
|---|---|
| PubChem CID | 142465392 |
| Molecular Formula | C19H20F5N7O3S |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.13 |
| IUPAC Name | 1-[5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3,3-trimethylurea |
| SMILES | CCS(=O)(=O)c1ccc(N(C)C(=O)N(C)C)nc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C19H20F5N7O3S/c1-6-35(33,34)11-7-8-13(30(4)17(32)29(2)3)26-14(11)16-25-10-9-12(18(20,21)19(22,23)24)27-28-15(10)31(16)5/h7-9H,6H2,1-5H3 |
| InChIKey | DHSPQAGIYDBGII-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 114.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|