C17H16F5N7O2S — CID 142465399
1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea (PubChem CID 142465399) has the molecular formula C17H16F5N7O2S and a molecular weight of 477.42 g/mol. Its IUPAC name is 1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea.
| Compound Name | 1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea |
|---|---|
| PubChem CID | 142465399 |
| Molecular Formula | C17H16F5N7O2S |
| Molecular Weight | 477.42 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-3-methylurea |
| SMILES | CCS(=O)c1ccc(NC(=O)NC)nc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C17H16F5N7O2S/c1-4-32(31)9-5-6-11(26-15(30)23-2)25-12(9)14-24-8-7-10(16(18,19)17(20,21)22)27-28-13(8)29(14)3/h5-7H,4H2,1-3H3,(H2,23,25,26,30) |
| InChIKey | KRPFMFPLBATNJD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 114.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|