C16H14F5N7O3S — CID 142465400
1-methyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea (PubChem CID 142465400) has the molecular formula C16H14F5N7O3S and a molecular weight of 479.39 g/mol. Its IUPAC name is 1-methyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea.
| Compound Name | 1-methyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea |
|---|---|
| PubChem CID | 142465400 |
| Molecular Formula | C16H14F5N7O3S |
| Molecular Weight | 479.39 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 1-methyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea |
| SMILES | CNC(=O)Nc1ccc(S(C)(=O)=O)c(-c2nc3cc(C(F)(F)C(F)(F)F)nnc3n2C)n1 |
| InChI | InChI=1S/C16H14F5N7O3S/c1-22-14(29)25-10-5-4-8(32(3,30)31)11(24-10)13-23-7-6-9(15(17,18)16(19,20)21)26-27-12(7)28(13)2/h4-6H,1-3H3,(H2,22,24,25,29) |
| InChIKey | VVNHOIIMTQOWFG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 131.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|