C18H18F5N7O2S — CID 142465407
1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3-dimethylurea (PubChem CID 142465407) has the molecular formula C18H18F5N7O2S and a molecular weight of 491.45 g/mol. Its IUPAC name is 1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3-dimethylurea.
| Compound Name | 1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3-dimethylurea |
|---|---|
| PubChem CID | 142465407 |
| Molecular Formula | C18H18F5N7O2S |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[5-ethylsulfinyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-2-pyridinyl]-1,3-dimethylurea |
| SMILES | CCS(=O)c1ccc(N(C)C(=O)NC)nc1-c1nc2cc(C(F)(F)C(F)(F)F)nnc2n1C |
| InChI | InChI=1S/C18H18F5N7O2S/c1-5-33(32)10-6-7-12(29(3)16(31)24-2)26-13(10)15-25-9-8-11(17(19,20)18(21,22)23)27-28-14(9)30(15)4/h6-8H,5H2,1-4H3,(H,24,31) |
| InChIKey | BZZGWEFWIWTLOG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 105.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|