C17H16F5N7O3S — CID 142465418
1,1-dimethyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea (PubChem CID 142465418) has the molecular formula C17H16F5N7O3S and a molecular weight of 493.42 g/mol. Its IUPAC name is 1,1-dimethyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea.
| Compound Name | 1,1-dimethyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea |
|---|---|
| PubChem CID | 142465418 |
| Molecular Formula | C17H16F5N7O3S |
| Molecular Weight | 493.42 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 1,1-dimethyl-3-[6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]-5-methylsulfonyl-2-pyridinyl]urea |
| SMILES | CN(C)C(=O)Nc1ccc(S(C)(=O)=O)c(-c2nc3cc(C(F)(F)C(F)(F)F)nnc3n2C)n1 |
| InChI | InChI=1S/C17H16F5N7O3S/c1-28(2)15(30)25-11-6-5-9(33(4,31)32)12(24-11)14-23-8-7-10(16(18,19)17(20,21)22)26-27-13(8)29(14)3/h5-7H,1-4H3,(H,24,25,30) |
| InChIKey | ZCFIVSLNSGZXIX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|