C18H17F5N6O3S — CID 142465426
N-ethyl-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxamide (PubChem CID 142465426) has the molecular formula C18H17F5N6O3S and a molecular weight of 492.43 g/mol. Its IUPAC name is N-ethyl-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxamide.
| Compound Name | N-ethyl-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142465426 |
| Molecular Formula | C18H17F5N6O3S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | N-ethyl-5-ethylsulfonyl-6-[7-methyl-3-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridazin-6-yl]pyridine-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(S(=O)(=O)CC)c(-c2nc3cc(C(F)(F)C(F)(F)F)nnc3n2C)n1 |
| InChI | InChI=1S/C18H17F5N6O3S/c1-4-24-16(30)9-6-7-11(33(31,32)5-2)13(25-9)15-26-10-8-12(17(19,20)18(21,22)23)27-28-14(10)29(15)3/h6-8H,4-5H2,1-3H3,(H,24,30) |
| InChIKey | MIXLGQRTCCVXOG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 119.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|