About 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine
6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine (PubChem CID 142465460) has the molecular formula C18H14Cl2FNO2
and a molecular weight of 366.22 g/mol. Its IUPAC name is 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine.
Molecular Properties
| Compound Name | 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine |
| PubChem CID | 142465460 |
| Molecular Formula | C18H14Cl2FNO2 |
| Molecular Weight | 366.22 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine |
| SMILES | CCOc1ccc(COc2cccc3c(Cl)c(Cl)ccc23)nc1F |
| InChI | InChI=1S/C18H14Cl2FNO2/c1-2-23-16-9-6-11(22-18(16)21)10-24-15-5-3-4-13-12(15)7-8-14(19)17(13)20/h3-9H,2,10H2,1H3 |
| InChIKey | KPJZULHRLSPKPU-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.22 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine?
The IUPAC name of 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine (CID 142465460) is 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine.
What is the SMILES notation for 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine?
The canonical SMILES for 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine is CCOc1ccc(COc2cccc3c(Cl)c(Cl)ccc23)nc1F.
What is the InChIKey of 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine?
The InChIKey is KPJZULHRLSPKPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl2FNO2/c1-2-23-16-9-6-11(22-18(16)21)10-24-15-5-3-4-13-12(15)7-8-14(19)17(13)20/h3-9H,2,10H2,1H3.
What are the key properties of 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine?
6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine has a molecular weight of 366.22 g/mol, XLogP of 5.66, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5,6-dichloronaphthalen-1-yl)oxymethyl]-3-ethoxy-2-fluoropyridine is sourced from PubChem (CID 142465460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).