About methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine
methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine (PubChem CID 142465533) has the molecular formula C10H25N3O
and a molecular weight of 203.33 g/mol. Its IUPAC name is methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine.
Molecular Properties
| Compound Name | methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine |
| PubChem CID | 142465533 |
| Molecular Formula | C10H25N3O |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.20 |
| IUPAC Name | methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine |
| SMILES | CCNC.CO/C=N/CCCN(C)C |
| InChI | InChI=1S/C7H16N2O.C3H9N/c1-9(2)6-4-5-8-7-10-3;1-3-4-2/h7H,4-6H2,1-3H3;4H,3H2,1-2H3/b8-7+; |
| InChIKey | JVLXMQDUQUKQGP-USRGLUTNSA-N |
| XLogP | 0.84 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine?
The IUPAC name of methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine (CID 142465533) is methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine.
What is the SMILES notation for methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine?
The canonical SMILES for methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine is CCNC.CO/C=N/CCCN(C)C.
What is the InChIKey of methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine?
The InChIKey is JVLXMQDUQUKQGP-USRGLUTNSA-N. The full InChI is InChI=1S/C7H16N2O.C3H9N/c1-9(2)6-4-5-8-7-10-3;1-3-4-2/h7H,4-6H2,1-3H3;4H,3H2,1-2H3/b8-7+;.
What are the key properties of methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine?
methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine has a molecular weight of 203.33 g/mol, XLogP of 0.84, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[3-(dimethylamino)propyl]methanimidate;N-methylethanamine is sourced from PubChem (CID 142465533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).