C16H23BClF2N3O4S — CID 142466404
6-chloro-2-(2,2-difluoroethylamino)-N'-methylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide (PubChem CID 142466404) has the molecular formula C16H23BClF2N3O4S and a molecular weight of 437.71 g/mol. Its IUPAC name is 6-chloro-2-(2,2-difluoroethylamino)-N'-methylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide.
| Compound Name | 6-chloro-2-(2,2-difluoroethylamino)-N'-methylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 142466404 |
| Molecular Formula | C16H23BClF2N3O4S |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 6-chloro-2-(2,2-difluoroethylamino)-N'-methylsulfonyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenecarboximidamide |
| SMILES | CC1(C)OB(c2ccc(Cl)c(/C(N)=N/S(C)(=O)=O)c2NCC(F)F)OC1(C)C |
| InChI | InChI=1S/C16H23BClF2N3O4S/c1-15(2)16(3,4)27-17(26-15)9-6-7-10(18)12(13(9)22-8-11(19)20)14(21)23-28(5,24)25/h6-7,11,22H,8H2,1-5H3,(H2,21,23) |
| InChIKey | OMKYEPCGKDAHNC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|