About 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine
7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine (PubChem CID 142466421) has the molecular formula C10H9BrClF2N3S
and a molecular weight of 356.62 g/mol. Its IUPAC name is 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine.
Molecular Properties
| Compound Name | 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine |
| PubChem CID | 142466421 |
| Molecular Formula | C10H9BrClF2N3S |
| Molecular Weight | 356.62 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine |
| SMILES | CSNc1nn(CC(F)F)c2c(Br)ccc(Cl)c12 |
| InChI | InChI=1S/C10H9BrClF2N3S/c1-18-16-10-8-6(12)3-2-5(11)9(8)17(15-10)4-7(13)14/h2-3,7H,4H2,1H3,(H,15,16) |
| InChIKey | XJDPYYMAVMQALC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine?
The IUPAC name of 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine (CID 142466421) is 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine.
What is the SMILES notation for 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine?
The canonical SMILES for 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine is CSNc1nn(CC(F)F)c2c(Br)ccc(Cl)c12.
What is the InChIKey of 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine?
The InChIKey is XJDPYYMAVMQALC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrClF2N3S/c1-18-16-10-8-6(12)3-2-5(11)9(8)17(15-10)4-7(13)14/h2-3,7H,4H2,1H3,(H,15,16).
What are the key properties of 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine?
7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine has a molecular weight of 356.62 g/mol, XLogP of 4.41, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-4-chloro-1-(2,2-difluoroethyl)-N-methylsulfanylindazol-3-amine is sourced from PubChem (CID 142466421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).