About ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate
ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate (PubChem CID 142466428) has the molecular formula C16H22F2N2O3
and a molecular weight of 328.36 g/mol. Its IUPAC name is ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate.
Molecular Properties
| Compound Name | ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate |
| PubChem CID | 142466428 |
| Molecular Formula | C16H22F2N2O3 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate |
| SMILES | [H]/N=C(\OCC)[C@H](Cc1cc(F)cc(F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H22F2N2O3/c1-5-22-14(19)13(20-15(21)23-16(2,3)4)8-10-6-11(17)9-12(18)7-10/h6-7,9,13,19H,5,8H2,1-4H3,(H,20,21)/b19-14-/t13-/m0/s1 |
| InChIKey | ZAHNPMDBGVEJCZ-ISNHLSKGSA-N |
| XLogP | 3.41 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate?
The IUPAC name of ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate (CID 142466428) is ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate.
What is the SMILES notation for ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate?
The canonical SMILES for ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate is [H]/N=C(\OCC)[C@H](Cc1cc(F)cc(F)c1)NC(=O)OC(C)(C)C.
What is the InChIKey of ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate?
The InChIKey is ZAHNPMDBGVEJCZ-ISNHLSKGSA-N. The full InChI is InChI=1S/C16H22F2N2O3/c1-5-22-14(19)13(20-15(21)23-16(2,3)4)8-10-6-11(17)9-12(18)7-10/h6-7,9,13,19H,5,8H2,1-4H3,(H,20,21)/b19-14-/t13-/m0/s1.
What are the key properties of ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate?
ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate has a molecular weight of 328.36 g/mol, XLogP of 3.41, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2S)-3-(3,5-difluorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanimidate is sourced from PubChem (CID 142466428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).