About acetylene;ethane;4-propylmorpholin-3-one
acetylene;ethane;4-propylmorpholin-3-one (PubChem CID 142466574) has the molecular formula C15H33NO2
and a molecular weight of 259.43 g/mol. Its IUPAC name is acetylene;ethane;4-propylmorpholin-3-one.
Molecular Properties
| Compound Name | acetylene;ethane;4-propylmorpholin-3-one |
| PubChem CID | 142466574 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | acetylene;ethane;4-propylmorpholin-3-one |
| SMILES | C#C.CC.CC.CC.CCCN1CCOCC1=O |
| InChI | InChI=1S/C7H13NO2.3C2H6.C2H2/c1-2-3-8-4-5-10-6-7(8)9;4*1-2/h2-6H2,1H3;3*1-2H3;1-2H |
| InChIKey | RMRKDPOVQCXEIX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;4-propylmorpholin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;4-propylmorpholin-3-one?
The IUPAC name of acetylene;ethane;4-propylmorpholin-3-one (CID 142466574) is acetylene;ethane;4-propylmorpholin-3-one.
What is the SMILES notation for acetylene;ethane;4-propylmorpholin-3-one?
The canonical SMILES for acetylene;ethane;4-propylmorpholin-3-one is C#C.CC.CC.CC.CCCN1CCOCC1=O.
What is the InChIKey of acetylene;ethane;4-propylmorpholin-3-one?
The InChIKey is RMRKDPOVQCXEIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.3C2H6.C2H2/c1-2-3-8-4-5-10-6-7(8)9;4*1-2/h2-6H2,1H3;3*1-2H3;1-2H.
What are the key properties of acetylene;ethane;4-propylmorpholin-3-one?
acetylene;ethane;4-propylmorpholin-3-one has a molecular weight of 259.43 g/mol, XLogP of 3.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;4-propylmorpholin-3-one is sourced from PubChem (CID 142466574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).