About [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium
[6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium (PubChem CID 142466607) has the molecular formula C14H14F2N3O2+
and a molecular weight of 294.28 g/mol. Its IUPAC name is [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium.
Molecular Properties
| Compound Name | [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium |
| PubChem CID | 142466607 |
| Molecular Formula | C14H14F2N3O2+ |
| Molecular Weight | 294.28 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium |
| SMILES | [H]/N=C(\C)c1c([NH2+]C)[nH]c(-c2ccc(F)c(F)c2)c(O)c1=O |
| InChI | InChI=1S/C14H13F2N3O2/c1-6(17)10-12(20)13(21)11(19-14(10)18-2)7-3-4-8(15)9(16)5-7/h3-5,17,21H,1-2H3,(H2,18,19,20)/p+1/b17-6+ |
| InChIKey | WWJJBKJDXRWTJR-UBKPWBPPSA-O |
| XLogP | 1.24 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium?
The IUPAC name of [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium (CID 142466607) is [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium.
What is the SMILES notation for [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium?
The canonical SMILES for [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium is [H]/N=C(\C)c1c([NH2+]C)[nH]c(-c2ccc(F)c(F)c2)c(O)c1=O.
What is the InChIKey of [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium?
The InChIKey is WWJJBKJDXRWTJR-UBKPWBPPSA-O. The full InChI is InChI=1S/C14H13F2N3O2/c1-6(17)10-12(20)13(21)11(19-14(10)18-2)7-3-4-8(15)9(16)5-7/h3-5,17,21H,1-2H3,(H2,18,19,20)/p+1/b17-6+.
What are the key properties of [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium?
[6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium has a molecular weight of 294.28 g/mol, XLogP of 1.24, 3 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(3,4-difluorophenyl)-3-ethanimidoyl-5-hydroxy-4-oxo-1H-pyridin-2-yl]-methylazanium is sourced from PubChem (CID 142466607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).