About 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one
2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one (PubChem CID 142466656) has the molecular formula C17H17F2N3O2
and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one.
Molecular Properties
| Compound Name | 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one |
| PubChem CID | 142466656 |
| Molecular Formula | C17H17F2N3O2 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one |
| SMILES | [H]/N=C(\C)c1c(NC2CCC2)[nH]c(-c2c(F)cccc2F)c(O)c1=O |
| InChI | InChI=1S/C17H17F2N3O2/c1-8(20)12-15(23)16(24)14(13-10(18)6-3-7-11(13)19)22-17(12)21-9-4-2-5-9/h3,6-7,9,20,24H,2,4-5H2,1H3,(H2,21,22,23)/b20-8+ |
| InChIKey | IWEFIHXGWGZBBD-DNTJNYDQSA-N |
| XLogP | 3.38 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one?
The IUPAC name of 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one (CID 142466656) is 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one.
What is the SMILES notation for 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one?
The canonical SMILES for 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one is [H]/N=C(\C)c1c(NC2CCC2)[nH]c(-c2c(F)cccc2F)c(O)c1=O.
What is the InChIKey of 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one?
The InChIKey is IWEFIHXGWGZBBD-DNTJNYDQSA-N. The full InChI is InChI=1S/C17H17F2N3O2/c1-8(20)12-15(23)16(24)14(13-10(18)6-3-7-11(13)19)22-17(12)21-9-4-2-5-9/h3,6-7,9,20,24H,2,4-5H2,1H3,(H2,21,22,23)/b20-8+.
What are the key properties of 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one?
2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one has a molecular weight of 333.34 g/mol, XLogP of 3.38, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclobutylamino)-6-(2,6-difluorophenyl)-3-ethanimidoyl-5-hydroxy-1H-pyridin-4-one is sourced from PubChem (CID 142466656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).