C17H17F4N3O2 — CID 142466693
2-(2-fluorophenyl)-3-hydroxy-6-(2-methylpropylamino)-5-(2,2,2-trifluoroethanimidoyl)-1H-pyridin-4-one (PubChem CID 142466693) has the molecular formula C17H17F4N3O2 and a molecular weight of 371.33 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3-hydroxy-6-(2-methylpropylamino)-5-(2,2,2-trifluoroethanimidoyl)-1H-pyridin-4-one.
| Compound Name | 2-(2-fluorophenyl)-3-hydroxy-6-(2-methylpropylamino)-5-(2,2,2-trifluoroethanimidoyl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 142466693 |
| Molecular Formula | C17H17F4N3O2 |
| Molecular Weight | 371.33 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 2-(2-fluorophenyl)-3-hydroxy-6-(2-methylpropylamino)-5-(2,2,2-trifluoroethanimidoyl)-1H-pyridin-4-one |
| SMILES | [H]/N=C(/c1c(NCC(C)C)[nH]c(-c2ccccc2F)c(O)c1=O)C(F)(F)F |
| InChI | InChI=1S/C17H17F4N3O2/c1-8(2)7-23-16-11(15(22)17(19,20)21)13(25)14(26)12(24-16)9-5-3-4-6-10(9)18/h3-6,8,22,26H,7H2,1-2H3,(H2,23,24,25)/b22-15- |
| InChIKey | QLUZPUUYBXBKHX-JCMHNJIXSA-N |
| XLogP | 3.88 |
| TPSA | 88.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.33 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|