About ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine
ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine (PubChem CID 142466751) has the molecular formula C22H49FN4
and a molecular weight of 388.66 g/mol. Its IUPAC name is ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine.
Molecular Properties
| Compound Name | ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine |
| PubChem CID | 142466751 |
| Molecular Formula | C22H49FN4 |
| Molecular Weight | 388.66 g/mol |
| Exact Mass | 388.39 |
| IUPAC Name | ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine |
| SMILES | CC.CC.CC.CC.CCc1c(C)c(CN2CCN(CCF)CC2)nn1C |
| InChI | InChI=1S/C14H25FN4.4C2H6/c1-4-14-12(2)13(16-17(14)3)11-19-9-7-18(6-5-15)8-10-19;4*1-2/h4-11H2,1-3H3;4*1-2H3 |
| InChIKey | MVIXENDCIHXZRE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.66 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine?
The IUPAC name of ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine (CID 142466751) is ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine.
What is the SMILES notation for ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine?
The canonical SMILES for ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine is CC.CC.CC.CC.CCc1c(C)c(CN2CCN(CCF)CC2)nn1C.
What is the InChIKey of ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine?
The InChIKey is MVIXENDCIHXZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25FN4.4C2H6/c1-4-14-12(2)13(16-17(14)3)11-19-9-7-18(6-5-15)8-10-19;4*1-2/h4-11H2,1-3H3;4*1-2H3.
What are the key properties of ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine?
ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine has a molecular weight of 388.66 g/mol, XLogP of 5.48, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[(5-ethyl-1,4-dimethylpyrazol-3-yl)methyl]-4-(2-fluoroethyl)piperazine is sourced from PubChem (CID 142466751), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).