C32H42N6O3 — CID 142467184
tert-butyl 3-[[2-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-1,6-naphthyridin-4-yl]amino]pyrrolidine-1-carboxylate (PubChem CID 142467184) has the molecular formula C32H42N6O3 and a molecular weight of 558.73 g/mol. Its IUPAC name is tert-butyl 3-[[2-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-1,6-naphthyridin-4-yl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[2-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-1,6-naphthyridin-4-yl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 142467184 |
| Molecular Formula | C32H42N6O3 |
| Molecular Weight | 558.73 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | tert-butyl 3-[[2-[4-(3-piperidin-1-ylpropylcarbamoyl)phenyl]-1,6-naphthyridin-4-yl]amino]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Nc2cc(-c3ccc(C(=O)NCCCN4CCCCC4)cc3)nc3ccncc23)C1 |
| InChI | InChI=1S/C32H42N6O3/c1-32(2,3)41-31(40)38-19-13-25(22-38)35-29-20-28(36-27-12-15-33-21-26(27)29)23-8-10-24(11-9-23)30(39)34-14-7-18-37-16-5-4-6-17-37/h8-12,15,20-21,25H,4-7,13-14,16-19,22H2,1-3H3,(H,34,39)(H,35,36) |
| InChIKey | WBZDAEIUGKSANL-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.73 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|