About 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine
1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine (PubChem CID 142467215) has the molecular formula C11H20N2
and a molecular weight of 180.30 g/mol. Its IUPAC name is 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine.
Molecular Properties
| Compound Name | 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine |
| PubChem CID | 142467215 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.30 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine |
| SMILES | C=C(/C=C/C)NC1CCN(C)CC1 |
| InChI | InChI=1S/C11H20N2/c1-4-5-10(2)12-11-6-8-13(3)9-7-11/h4-5,11-12H,2,6-9H2,1,3H3/b5-4+ |
| InChIKey | ORAFRELVEBNNNY-SNAWJCMRSA-N |
| XLogP | 1.76 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.30 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine?
The IUPAC name of 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine (CID 142467215) is 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine.
What is the SMILES notation for 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine?
The canonical SMILES for 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine is C=C(/C=C/C)NC1CCN(C)CC1.
What is the InChIKey of 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine?
The InChIKey is ORAFRELVEBNNNY-SNAWJCMRSA-N. The full InChI is InChI=1S/C11H20N2/c1-4-5-10(2)12-11-6-8-13(3)9-7-11/h4-5,11-12H,2,6-9H2,1,3H3/b5-4+.
What are the key properties of 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine?
1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine has a molecular weight of 180.30 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-N-[(3E)-penta-1,3-dien-2-yl]piperidin-4-amine is sourced from PubChem (CID 142467215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).