C27H35N5O2 — CID 142467247
(E)-N,N-diethyl-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide (PubChem CID 142467247) has the molecular formula C27H35N5O2 and a molecular weight of 461.61 g/mol. Its IUPAC name is (E)-N,N-diethyl-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N,N-diethyl-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 142467247 |
| Molecular Formula | C27H35N5O2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | (E)-N,N-diethyl-3-[5-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]furan-2-yl]prop-2-enamide |
| SMILES | CCN(CC)C(=O)/C=C/c1ccc(-c2cc(NCCCN3CCCCC3)c3cnccc3n2)o1 |
| InChI | InChI=1S/C27H35N5O2/c1-3-32(4-2)27(33)12-10-21-9-11-26(34-21)25-19-24(22-20-28-15-13-23(22)30-25)29-14-8-18-31-16-6-5-7-17-31/h9-13,15,19-20H,3-8,14,16-18H2,1-2H3,(H,29,30)/b12-10+ |
| InChIKey | CJXTYWHKNUUPJN-ZRDIBKRKSA-N |
| XLogP | 5.06 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|