C25H33ClN4O — CID 142467341
4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide;ethane (PubChem CID 142467341) has the molecular formula C25H33ClN4O and a molecular weight of 441.02 g/mol. Its IUPAC name is 4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide;ethane.
| Compound Name | 4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide;ethane |
|---|---|
| PubChem CID | 142467341 |
| Molecular Formula | C25H33ClN4O |
| Molecular Weight | 441.02 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | 4-(4-chloro-1,6-naphthyridin-2-yl)-N-(1-methylpiperidin-4-yl)benzamide;ethane |
| SMILES | CC.CC.CN1CCC(NC(=O)c2ccc(-c3cc(Cl)c4cnccc4n3)cc2)CC1 |
| InChI | InChI=1S/C21H21ClN4O.2C2H6/c1-26-10-7-16(8-11-26)24-21(27)15-4-2-14(3-5-15)20-12-18(22)17-13-23-9-6-19(17)25-20;2*1-2/h2-6,9,12-13,16H,7-8,10-11H2,1H3,(H,24,27);2*1-2H3 |
| InChIKey | LGFBGZPUNIEWCK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.02 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |