C26H37N5O2 — CID 142467350
ethane;methanamine;4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoic acid (PubChem CID 142467350) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is ethane;methanamine;4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoic acid.
| Compound Name | ethane;methanamine;4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 142467350 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | ethane;methanamine;4-[4-(3-piperidin-1-ylpropylamino)-1,6-naphthyridin-2-yl]benzoic acid |
| SMILES | CC.CN.O=C(O)c1ccc(-c2cc(NCCCN3CCCCC3)c3cnccc3n2)cc1 |
| InChI | InChI=1S/C23H26N4O2.C2H6.CH5N/c28-23(29)18-7-5-17(6-8-18)21-15-22(19-16-24-11-9-20(19)26-21)25-10-4-14-27-12-2-1-3-13-27;2*1-2/h5-9,11,15-16H,1-4,10,12-14H2,(H,25,26)(H,28,29);1-2H3;2H2,1H3 |
| InChIKey | JONMMZIVPAIFPP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|