About ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine
ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine (PubChem CID 142467806) has the molecular formula C13H28N6
and a molecular weight of 268.41 g/mol. Its IUPAC name is ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine.
Molecular Properties
| Compound Name | ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine |
| PubChem CID | 142467806 |
| Molecular Formula | C13H28N6 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine |
| SMILES | CC.CCCN.[H]/N=C(\C)c1c(N)ncnc1NCC |
| InChI | InChI=1S/C8H13N5.C3H9N.C2H6/c1-3-11-8-6(5(2)9)7(10)12-4-13-8;1-2-3-4;1-2/h4,9H,3H2,1-2H3,(H3,10,11,12,13);2-4H2,1H3;1-2H3/b9-5+;; |
| InChIKey | OJLKJLRFZUJMRS-KJDUPKRESA-N |
| XLogP | 2.26 |
| TPSA | 113.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine?
The IUPAC name of ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine (CID 142467806) is ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine.
What is the SMILES notation for ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine?
The canonical SMILES for ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine is CC.CCCN.[H]/N=C(\C)c1c(N)ncnc1NCC.
What is the InChIKey of ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine?
The InChIKey is OJLKJLRFZUJMRS-KJDUPKRESA-N. The full InChI is InChI=1S/C8H13N5.C3H9N.C2H6/c1-3-11-8-6(5(2)9)7(10)12-4-13-8;1-2-3-4;1-2/h4,9H,3H2,1-2H3,(H3,10,11,12,13);2-4H2,1H3;1-2H3/b9-5+;;.
What are the key properties of ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine?
ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine has a molecular weight of 268.41 g/mol, XLogP of 2.26, 4 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-ethanimidoyl-4-N-ethylpyrimidine-4,6-diamine;propan-1-amine is sourced from PubChem (CID 142467806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).