C6H6F6O2 — CID 14246829
2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane (PubChem CID 14246829) has the molecular formula C6H6F6O2 and a molecular weight of 224.10 g/mol. Its IUPAC name is 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane.
| Compound Name | 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane |
|---|---|
| PubChem CID | 14246829 |
| Molecular Formula | C6H6F6O2 |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | 2-(1,1,2,3,3,3-hexafluoropropoxymethyl)oxirane |
| SMILES | FC(C(F)(F)F)C(F)(F)OCC1CO1 |
| InChI | InChI=1S/C6H6F6O2/c7-4(5(8,9)10)6(11,12)14-2-3-1-13-3/h3-4H,1-2H2 |
| InChIKey | JMOAWAFFKGTPJU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|