About 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol
1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol (PubChem CID 142468418) has the molecular formula C12H21NO2
and a molecular weight of 211.30 g/mol. Its IUPAC name is 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol |
| PubChem CID | 142468418 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol |
| SMILES | CCC/C=C\C=C(/NOC)C1(O)CCC1 |
| InChI | InChI=1S/C12H21NO2/c1-3-4-5-6-8-11(13-15-2)12(14)9-7-10-12/h5-6,8,13-14H,3-4,7,9-10H2,1-2H3/b6-5-,11-8- |
| InChIKey | BLCAFMBXXJEQAF-VRULOHATSA-N |
| XLogP | 2.29 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol?
The IUPAC name of 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol (CID 142468418) is 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol.
What is the SMILES notation for 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol?
The canonical SMILES for 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol is CCC/C=C\C=C(/NOC)C1(O)CCC1.
What is the InChIKey of 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol?
The InChIKey is BLCAFMBXXJEQAF-VRULOHATSA-N. The full InChI is InChI=1S/C12H21NO2/c1-3-4-5-6-8-11(13-15-2)12(14)9-7-10-12/h5-6,8,13-14H,3-4,7,9-10H2,1-2H3/b6-5-,11-8-.
What are the key properties of 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol?
1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol has a molecular weight of 211.30 g/mol, XLogP of 2.29, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z,3Z)-1-(methoxyamino)hepta-1,3-dienyl]cyclobutan-1-ol is sourced from PubChem (CID 142468418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).