About 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol
1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol (PubChem CID 142468552) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol.
Molecular Properties
| Compound Name | 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol |
| PubChem CID | 142468552 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol |
| SMILES | OCCNCC(O)COC1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO3/c13-7-6-12-8-10(14)9-15-11-4-2-1-3-5-11/h2,4-5,10,12-14H,1,3,6-9H2 |
| InChIKey | BDIFKMZLERTHFN-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol?
The IUPAC name of 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol (CID 142468552) is 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol.
What is the SMILES notation for 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol?
The canonical SMILES for 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol is OCCNCC(O)COC1=CCCC=C1.
What is the InChIKey of 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol?
The InChIKey is BDIFKMZLERTHFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c13-7-6-12-8-10(14)9-15-11-4-2-1-3-5-11/h2,4-5,10,12-14H,1,3,6-9H2.
What are the key properties of 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol?
1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol has a molecular weight of 213.28 g/mol, XLogP of 0.18, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,5-dien-1-yloxy-3-(2-hydroxyethylamino)propan-2-ol is sourced from PubChem (CID 142468552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).