About 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one
6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one (PubChem CID 142468654) has the molecular formula C12H6FN3O4S
and a molecular weight of 307.26 g/mol. Its IUPAC name is 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one.
Molecular Properties
| Compound Name | 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one |
| PubChem CID | 142468654 |
| Molecular Formula | C12H6FN3O4S |
| Molecular Weight | 307.26 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one |
| SMILES | O=C1OC(N=Cc2nccs2)c2c1cc(F)cc2[N+](=O)[O-] |
| InChI | InChI=1S/C12H6FN3O4S/c13-6-3-7-10(8(4-6)16(18)19)11(20-12(7)17)15-5-9-14-1-2-21-9/h1-5,11H |
| InChIKey | DQYNDIHGBJXPJI-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 94.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one?
The IUPAC name of 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one (CID 142468654) is 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one.
What is the SMILES notation for 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one?
The canonical SMILES for 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one is O=C1OC(N=Cc2nccs2)c2c1cc(F)cc2[N+](=O)[O-].
What is the InChIKey of 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one?
The InChIKey is DQYNDIHGBJXPJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6FN3O4S/c13-6-3-7-10(8(4-6)16(18)19)11(20-12(7)17)15-5-9-14-1-2-21-9/h1-5,11H.
What are the key properties of 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one?
6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one has a molecular weight of 307.26 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-nitro-3-(1,3-thiazol-2-ylmethylideneamino)-3H-2-benzofuran-1-one is sourced from PubChem (CID 142468654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).